C12H23NO — CID 87095832
2-[ethyl(octa-3,7-dienyl)amino]ethanol (PubChem CID 87095832) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 2-[ethyl(octa-3,7-dienyl)amino]ethanol.
| Compound Name | 2-[ethyl(octa-3,7-dienyl)amino]ethanol |
|---|---|
| PubChem CID | 87095832 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 2-[ethyl(octa-3,7-dienyl)amino]ethanol |
| SMILES | C=CCCC=CCCN(CC)CCO |
| InChI | InChI=1S/C12H23NO/c1-3-5-6-7-8-9-10-13(4-2)11-12-14/h3,7-8,14H,1,4-6,9-12H2,2H3 |
| InChIKey | IFXLCMSESVDSHU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|