C17H23FN4O3 — CID 87095870
tert-butyl 4-[2-(2-fluoro-5H-1,2,4-oxadiazol-3-yl)phenyl]piperazine-1-carboxylate (PubChem CID 87095870) has the molecular formula C17H23FN4O3 and a molecular weight of 350.39 g/mol. Its IUPAC name is tert-butyl 4-[2-(2-fluoro-5H-1,2,4-oxadiazol-3-yl)phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(2-fluoro-5H-1,2,4-oxadiazol-3-yl)phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 87095870 |
| Molecular Formula | C17H23FN4O3 |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | tert-butyl 4-[2-(2-fluoro-5H-1,2,4-oxadiazol-3-yl)phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccccc2C2=NCON2F)CC1 |
| InChI | InChI=1S/C17H23FN4O3/c1-17(2,3)25-16(23)21-10-8-20(9-11-21)14-7-5-4-6-13(14)15-19-12-24-22(15)18/h4-7H,8-12H2,1-3H3 |
| InChIKey | JWNHMGTZYGWPCE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 57.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|