C12H16F8N2O4S — CID 87095993
1-butyl-3-methylimidazol-3-ium;1,1,2-trifluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethanesulfonate (PubChem CID 87095993) has the molecular formula C12H16F8N2O4S and a molecular weight of 436.32 g/mol. Its IUPAC name is 1-butyl-3-methylimidazol-3-ium;1,1,2-trifluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethanesulfonate.
| Compound Name | 1-butyl-3-methylimidazol-3-ium;1,1,2-trifluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethanesulfonate |
|---|---|
| PubChem CID | 87095993 |
| Molecular Formula | C12H16F8N2O4S |
| Molecular Weight | 436.32 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | 1-butyl-3-methylimidazol-3-ium;1,1,2-trifluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethanesulfonate |
| SMILES | CCCCn1cc[n+](C)c1.O=S(=O)([O-])C(F)(F)C(F)OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H15N2.C4H2F8O4S/c1-3-4-5-10-7-6-9(2)8-10;5-1(2(6,7)17(13,14)15)16-4(11,12)3(8,9)10/h6-8H,3-5H2,1-2H3;1H,(H,13,14,15)/q+1;/p-1 |
| InChIKey | ZIPFNZZMKGEBFU-UHFFFAOYSA-M |
| XLogP | 2.70 |
| TPSA | 75.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|