C19H18BrNO3 — CID 87096157
[1-[4-(2-bromo-2-phenylacetyl)phenyl]cyclobutyl]carbamic acid (PubChem CID 87096157) has the molecular formula C19H18BrNO3 and a molecular weight of 388.26 g/mol. Its IUPAC name is [1-[4-(2-bromo-2-phenylacetyl)phenyl]cyclobutyl]carbamic acid.
| Compound Name | [1-[4-(2-bromo-2-phenylacetyl)phenyl]cyclobutyl]carbamic acid |
|---|---|
| PubChem CID | 87096157 |
| Molecular Formula | C19H18BrNO3 |
| Molecular Weight | 388.26 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | [1-[4-(2-bromo-2-phenylacetyl)phenyl]cyclobutyl]carbamic acid |
| SMILES | O=C(O)NC1(c2ccc(C(=O)C(Br)c3ccccc3)cc2)CCC1 |
| InChI | InChI=1S/C19H18BrNO3/c20-16(13-5-2-1-3-6-13)17(22)14-7-9-15(10-8-14)19(11-4-12-19)21-18(23)24/h1-3,5-10,16,21H,4,11-12H2,(H,23,24) |
| InChIKey | CHTZVXFKFNSMLK-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.26 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|