C16H22BrNO — CID 12760544
2-bromo-3,3-dimethyl-N-(1-phenylcyclobutyl)butanamide (PubChem CID 12760544) has the molecular formula C16H22BrNO and a molecular weight of 324.26 g/mol. Its IUPAC name is 2-bromo-3,3-dimethyl-N-(1-phenylcyclobutyl)butanamide.
| Compound Name | 2-bromo-3,3-dimethyl-N-(1-phenylcyclobutyl)butanamide |
|---|---|
| PubChem CID | 12760544 |
| Molecular Formula | C16H22BrNO |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 2-bromo-3,3-dimethyl-N-(1-phenylcyclobutyl)butanamide |
| SMILES | CC(C)(C)C(Br)C(=O)NC1(c2ccccc2)CCC1 |
| InChI | InChI=1S/C16H22BrNO/c1-15(2,3)13(17)14(19)18-16(10-7-11-16)12-8-5-4-6-9-12/h4-6,8-9,13H,7,10-11H2,1-3H3,(H,18,19) |
| InChIKey | AIRXWGYMSMGEQX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|