C5H10N2O4 — CID 87096185
(2S)-2-amino-4-(hydroxymethylamino)-4-oxobutanoic acid (PubChem CID 87096185) has the molecular formula C5H10N2O4 and a molecular weight of 162.14 g/mol. Its IUPAC name is (2S)-2-amino-4-(hydroxymethylamino)-4-oxobutanoic acid.
| Compound Name | (2S)-2-amino-4-(hydroxymethylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 87096185 |
| Molecular Formula | C5H10N2O4 |
| Molecular Weight | 162.14 g/mol |
| Exact Mass | 162.06 |
| IUPAC Name | (2S)-2-amino-4-(hydroxymethylamino)-4-oxobutanoic acid |
| SMILES | N[C@@H](CC(=O)NCO)C(=O)O |
| InChI | InChI=1S/C5H10N2O4/c6-3(5(10)11)1-4(9)7-2-8/h3,8H,1-2,6H2,(H,7,9)(H,10,11)/t3-/m0/s1 |
| InChIKey | MJAMVIZTMDSXFI-VKHMYHEASA-N |
| XLogP | -2.15 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.14 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|