C15H26N3O3+ — CID 8709819
N-(cyclohexen-1-yl)-N-(2-methoxyethyl)-2-(3-oxopiperazin-1-ium-1-yl)acetamide (PubChem CID 8709819) has the molecular formula C15H26N3O3+ and a molecular weight of 296.39 g/mol. Its IUPAC name is N-(cyclohexen-1-yl)-N-(2-methoxyethyl)-2-(3-oxopiperazin-1-ium-1-yl)acetamide.
| Compound Name | N-(cyclohexen-1-yl)-N-(2-methoxyethyl)-2-(3-oxopiperazin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 8709819 |
| Molecular Formula | C15H26N3O3+ |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | N-(cyclohexen-1-yl)-N-(2-methoxyethyl)-2-(3-oxopiperazin-1-ium-1-yl)acetamide |
| SMILES | COCCN(C(=O)C[NH+]1CCNC(=O)C1)C1=CCCCC1 |
| InChI | InChI=1S/C15H25N3O3/c1-21-10-9-18(13-5-3-2-4-6-13)15(20)12-17-8-7-16-14(19)11-17/h5H,2-4,6-12H2,1H3,(H,16,19)/p+1 |
| InChIKey | DRBABYUXNOSZRH-UHFFFAOYSA-O |
| XLogP | -1.07 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |