C12H18N2O2 — CID 86749675
4-tert-butyl-6,7,8,8a-tetrahydro-1H-quinoxaline-2,3-dione (PubChem CID 86749675) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 4-tert-butyl-6,7,8,8a-tetrahydro-1H-quinoxaline-2,3-dione.
| Compound Name | 4-tert-butyl-6,7,8,8a-tetrahydro-1H-quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 86749675 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 4-tert-butyl-6,7,8,8a-tetrahydro-1H-quinoxaline-2,3-dione |
| SMILES | CC(C)(C)N1C(=O)C(=O)NC2CCCC=C21 |
| InChI | InChI=1S/C12H18N2O2/c1-12(2,3)14-9-7-5-4-6-8(9)13-10(15)11(14)16/h7-8H,4-6H2,1-3H3,(H,13,15) |
| InChIKey | YEHRBJNAPDCLFB-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|