C10H14N2O3 — CID 139233986
methyl (4aR,8aS)-3-oxo-2,4,4a,7,8,8a-hexahydroquinoxaline-1-carboxylate (PubChem CID 139233986) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is methyl (4aR,8aS)-3-oxo-2,4,4a,7,8,8a-hexahydroquinoxaline-1-carboxylate.
| Compound Name | methyl (4aR,8aS)-3-oxo-2,4,4a,7,8,8a-hexahydroquinoxaline-1-carboxylate |
|---|---|
| PubChem CID | 139233986 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | methyl (4aR,8aS)-3-oxo-2,4,4a,7,8,8a-hexahydroquinoxaline-1-carboxylate |
| SMILES | COC(=O)N1CC(=O)N[C@@H]2C=CCC[C@@H]21 |
| InChI | InChI=1S/C10H14N2O3/c1-15-10(14)12-6-9(13)11-7-4-2-3-5-8(7)12/h2,4,7-8H,3,5-6H2,1H3,(H,11,13)/t7-,8+/m1/s1 |
| InChIKey | UQRZBPNTOYMYHL-SFYZADRCSA-N |
| XLogP | 0.27 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|