C8H10N2O2 — CID 45088897
(9aS)-3,6,9,9a-tetrahydro-2H-pyrido[1,2-a]pyrazine-1,4-dione (PubChem CID 45088897) has the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. Its IUPAC name is (9aS)-3,6,9,9a-tetrahydro-2H-pyrido[1,2-a]pyrazine-1,4-dione.
| Compound Name | (9aS)-3,6,9,9a-tetrahydro-2H-pyrido[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 45088897 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | (9aS)-3,6,9,9a-tetrahydro-2H-pyrido[1,2-a]pyrazine-1,4-dione |
| SMILES | O=C1NCC(=O)N2CC=CC[C@@H]12 |
| InChI | InChI=1S/C8H10N2O2/c11-7-5-9-8(12)6-3-1-2-4-10(6)7/h1-2,6H,3-5H2,(H,9,12)/t6-/m0/s1 |
| InChIKey | PALFNRKPVIXXLR-LURJTMIESA-N |
| XLogP | -0.73 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|