C9H20N2O2 — CID 87098202
3-(dimethylamino)propanoic acid;N-methylprop-2-en-1-amine (PubChem CID 87098202) has the molecular formula C9H20N2O2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 3-(dimethylamino)propanoic acid;N-methylprop-2-en-1-amine.
| Compound Name | 3-(dimethylamino)propanoic acid;N-methylprop-2-en-1-amine |
|---|---|
| PubChem CID | 87098202 |
| Molecular Formula | C9H20N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | 3-(dimethylamino)propanoic acid;N-methylprop-2-en-1-amine |
| SMILES | C=CCNC.CN(C)CCC(=O)O |
| InChI | InChI=1S/C5H11NO2.C4H9N/c1-6(2)4-3-5(7)8;1-3-4-5-2/h3-4H2,1-2H3,(H,7,8);3,5H,1,4H2,2H3 |
| InChIKey | ITIVFJNYRPLUTE-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|