C14H24N3O2+ — CID 8709857
N-(cyclohexen-1-yl)-N-ethyl-2-(3-oxopiperazin-1-ium-1-yl)acetamide (PubChem CID 8709857) has the molecular formula C14H24N3O2+ and a molecular weight of 266.36 g/mol. Its IUPAC name is N-(cyclohexen-1-yl)-N-ethyl-2-(3-oxopiperazin-1-ium-1-yl)acetamide.
| Compound Name | N-(cyclohexen-1-yl)-N-ethyl-2-(3-oxopiperazin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 8709857 |
| Molecular Formula | C14H24N3O2+ |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | N-(cyclohexen-1-yl)-N-ethyl-2-(3-oxopiperazin-1-ium-1-yl)acetamide |
| SMILES | CCN(C(=O)C[NH+]1CCNC(=O)C1)C1=CCCCC1 |
| InChI | InChI=1S/C14H23N3O2/c1-2-17(12-6-4-3-5-7-12)14(19)11-16-9-8-15-13(18)10-16/h6H,2-5,7-11H2,1H3,(H,15,18)/p+1 |
| InChIKey | SPUFXUNGEPPGOU-UHFFFAOYSA-O |
| XLogP | -0.69 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |