About CID 87098693
CID 87098693 (PubChem CID 87098693) has the molecular formula C10H22O2SSi
and a molecular weight of 234.44 g/mol.
Molecular Properties
| Compound Name | CID 87098693 |
| PubChem CID | 87098693 |
| Molecular Formula | C10H22O2SSi |
| Molecular Weight | 234.44 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | — |
| SMILES | CC(C)OC(OC(C)C)[Si]CCCS |
| InChI | InChI=1S/C10H22O2SSi/c1-8(2)11-10(12-9(3)4)14-7-5-6-13/h8-10,13H,5-7H2,1-4H3 |
| InChIKey | MUUAAFVTVFYKPU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 87098693 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87098693?
The IUPAC name of CID 87098693 (CID 87098693) is not available.
What is the SMILES notation for CID 87098693?
The canonical SMILES for CID 87098693 is CC(C)OC(OC(C)C)[Si]CCCS.
What is the InChIKey of CID 87098693?
The InChIKey is MUUAAFVTVFYKPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O2SSi/c1-8(2)11-10(12-9(3)4)14-7-5-6-13/h8-10,13H,5-7H2,1-4H3.
What are the key properties of CID 87098693?
CID 87098693 has a molecular weight of 234.44 g/mol, XLogP of 2.56, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87098693 is sourced from PubChem (CID 87098693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).