About 2-(1-aminohexoxy)ethanol
2-(1-aminohexoxy)ethanol (PubChem CID 87099968) has the molecular formula C8H19NO2
and a molecular weight of 161.24 g/mol. Its IUPAC name is 2-(1-aminohexoxy)ethanol.
Molecular Properties
| Compound Name | 2-(1-aminohexoxy)ethanol |
| PubChem CID | 87099968 |
| Molecular Formula | C8H19NO2 |
| Molecular Weight | 161.24 g/mol |
| Exact Mass | 161.14 |
| IUPAC Name | 2-(1-aminohexoxy)ethanol |
| SMILES | CCCCCC(N)OCCO |
| InChI | InChI=1S/C8H19NO2/c1-2-3-4-5-8(9)11-7-6-10/h8,10H,2-7,9H2,1H3 |
| InChIKey | UGGARDOCZKGNKI-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.24 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-aminohexoxy)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-aminohexoxy)ethanol?
The IUPAC name of 2-(1-aminohexoxy)ethanol (CID 87099968) is 2-(1-aminohexoxy)ethanol.
What is the SMILES notation for 2-(1-aminohexoxy)ethanol?
The canonical SMILES for 2-(1-aminohexoxy)ethanol is CCCCCC(N)OCCO.
What is the InChIKey of 2-(1-aminohexoxy)ethanol?
The InChIKey is UGGARDOCZKGNKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19NO2/c1-2-3-4-5-8(9)11-7-6-10/h8,10H,2-7,9H2,1H3.
What are the key properties of 2-(1-aminohexoxy)ethanol?
2-(1-aminohexoxy)ethanol has a molecular weight of 161.24 g/mol, XLogP of 0.86, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-aminohexoxy)ethanol is sourced from PubChem (CID 87099968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).