About tris(1-aminohexyl) phosphite
tris(1-aminohexyl) phosphite (PubChem CID 87256127) has the molecular formula C18H42N3O3P
and a molecular weight of 379.53 g/mol. Its IUPAC name is tris(1-aminohexyl) phosphite.
Molecular Properties
| Compound Name | tris(1-aminohexyl) phosphite |
| PubChem CID | 87256127 |
| Molecular Formula | C18H42N3O3P |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.30 |
| IUPAC Name | tris(1-aminohexyl) phosphite |
| SMILES | CCCCCC(N)OP(OC(N)CCCCC)OC(N)CCCCC |
| InChI | InChI=1S/C18H42N3O3P/c1-4-7-10-13-16(19)22-25(23-17(20)14-11-8-5-2)24-18(21)15-12-9-6-3/h16-18H,4-15,19-21H2,1-3H3 |
| InChIKey | DIMFLHFYXPJVMP-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 105.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tris(1-aminohexyl) phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(1-aminohexyl) phosphite?
The IUPAC name of tris(1-aminohexyl) phosphite (CID 87256127) is tris(1-aminohexyl) phosphite.
What is the SMILES notation for tris(1-aminohexyl) phosphite?
The canonical SMILES for tris(1-aminohexyl) phosphite is CCCCCC(N)OP(OC(N)CCCCC)OC(N)CCCCC.
What is the InChIKey of tris(1-aminohexyl) phosphite?
The InChIKey is DIMFLHFYXPJVMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H42N3O3P/c1-4-7-10-13-16(19)22-25(23-17(20)14-11-8-5-2)24-18(21)15-12-9-6-3/h16-18H,4-15,19-21H2,1-3H3.
What are the key properties of tris(1-aminohexyl) phosphite?
tris(1-aminohexyl) phosphite has a molecular weight of 379.53 g/mol, XLogP of 4.86, 18 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tris(1-aminohexyl) phosphite is sourced from PubChem (CID 87256127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).