C21H27N3O2S — CID 8710067
N-(2,3-dimethylphenyl)-2-[methyl-[2-oxo-2-[prop-2-enyl(thiophen-2-ylmethyl)amino]ethyl]amino]acetamide (PubChem CID 8710067) has the molecular formula C21H27N3O2S and a molecular weight of 385.53 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-[methyl-[2-oxo-2-[prop-2-enyl(thiophen-2-ylmethyl)amino]ethyl]amino]acetamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-[methyl-[2-oxo-2-[prop-2-enyl(thiophen-2-ylmethyl)amino]ethyl]amino]acetamide |
|---|---|
| PubChem CID | 8710067 |
| Molecular Formula | C21H27N3O2S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-[methyl-[2-oxo-2-[prop-2-enyl(thiophen-2-ylmethyl)amino]ethyl]amino]acetamide |
| SMILES | C=CCN(Cc1cccs1)C(=O)CN(C)CC(=O)Nc1cccc(C)c1C |
| InChI | InChI=1S/C21H27N3O2S/c1-5-11-24(13-18-9-7-12-27-18)21(26)15-23(4)14-20(25)22-19-10-6-8-16(2)17(19)3/h5-10,12H,1,11,13-15H2,2-4H3,(H,22,25) |
| InChIKey | RDFUHYVLGHQYIX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|