C17H17ClF2N2OS — CID 8710371
2-[[(1R)-1-(2-chlorophenyl)ethyl]amino]-N-[2-(difluoromethylsulfanyl)phenyl]acetamide (PubChem CID 8710371) has the molecular formula C17H17ClF2N2OS and a molecular weight of 370.85 g/mol. Its IUPAC name is 2-[[(1R)-1-(2-chlorophenyl)ethyl]amino]-N-[2-(difluoromethylsulfanyl)phenyl]acetamide.
| Compound Name | 2-[[(1R)-1-(2-chlorophenyl)ethyl]amino]-N-[2-(difluoromethylsulfanyl)phenyl]acetamide |
|---|---|
| PubChem CID | 8710371 |
| Molecular Formula | C17H17ClF2N2OS |
| Molecular Weight | 370.85 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 2-[[(1R)-1-(2-chlorophenyl)ethyl]amino]-N-[2-(difluoromethylsulfanyl)phenyl]acetamide |
| SMILES | C[C@@H](NCC(=O)Nc1ccccc1SC(F)F)c1ccccc1Cl |
| InChI | InChI=1S/C17H17ClF2N2OS/c1-11(12-6-2-3-7-13(12)18)21-10-16(23)22-14-8-4-5-9-15(14)24-17(19)20/h2-9,11,17,21H,10H2,1H3,(H,22,23)/t11-/m1/s1 |
| InChIKey | CIBVJEMJQDVCSG-LLVKDONJSA-N |
| XLogP | 4.94 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.85 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |