C36H57NO5 — CID 87104712
[(3S,6aR,6bS,8aS,11S,12aR,14aR,14bS)-11-[ethoxy(ethyl)carbamoyl]-4,4,6a,6b,8a,11,14b-heptamethyl-14-oxo-2,3,4a,5,6,7,8,9,10,12,12a,14a-dodecahydro-1H-picen-3-yl] acetate (PubChem CID 87104712) has the molecular formula C36H57NO5 and a molecular weight of 583.85 g/mol. Its IUPAC name is [(3S,6aR,6bS,8aS,11S,12aR,14aR,14bS)-11-[ethoxy(ethyl)carbamoyl]-4,4,6a,6b,8a,11,14b-heptamethyl-14-oxo-2,3,4a,5,6,7,8,9,10,12,12a,14a-dodecahydro-1H-picen-3-yl] acetate.
| Compound Name | [(3S,6aR,6bS,8aS,11S,12aR,14aR,14bS)-11-[ethoxy(ethyl)carbamoyl]-4,4,6a,6b,8a,11,14b-heptamethyl-14-oxo-2,3,4a,5,6,7,8,9,10,12,12a,14a-dodecahydro-1H-picen-3-yl] acetate |
|---|---|
| PubChem CID | 87104712 |
| Molecular Formula | C36H57NO5 |
| Molecular Weight | 583.85 g/mol |
| Exact Mass | 583.42 |
| IUPAC Name | [(3S,6aR,6bS,8aS,11S,12aR,14aR,14bS)-11-[ethoxy(ethyl)carbamoyl]-4,4,6a,6b,8a,11,14b-heptamethyl-14-oxo-2,3,4a,5,6,7,8,9,10,12,12a,14a-dodecahydro-1H-picen-3-yl] acetate |
| SMILES | CCON(CC)C(=O)[C@@]1(C)CC[C@]2(C)CC[C@]3(C)C(=CC(=O)[C@@H]4[C@@]5(C)CC[C@H](OC(C)=O)C(C)(C)C5CC[C@]43C)[C@@H]2C1 |
| InChI | InChI=1S/C36H57NO5/c1-11-37(41-12-2)30(40)33(7)18-17-32(6)19-20-35(9)24(25(32)22-33)21-26(39)29-34(8)15-14-28(42-23(3)38)31(4,5)27(34)13-16-36(29,35)10/h21,25,27-29H,11-20,22H2,1-10H3/t25-,27?,28-,29+,32+,33-,34-,35+,36+/m0/s1 |
| InChIKey | WGBITBPFKKDYBE-FKXKDEBHSA-N |
| XLogP | 7.70 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.85 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|