C34H56N2O3 — CID 87104858
(2S,4aS,6aR,6aS,6bR,10S,12aS,14bR)-10-amino-N-ethoxy-N-ethyl-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8a,10,11,12,14b-dodecahydro-1H-picene-2-carboxamide (PubChem CID 87104858) has the molecular formula C34H56N2O3 and a molecular weight of 540.83 g/mol. Its IUPAC name is (2S,4aS,6aR,6aS,6bR,10S,12aS,14bR)-10-amino-N-ethoxy-N-ethyl-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8a,10,11,12,14b-dodecahydro-1H-picene-2-carboxamide.
| Compound Name | (2S,4aS,6aR,6aS,6bR,10S,12aS,14bR)-10-amino-N-ethoxy-N-ethyl-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8a,10,11,12,14b-dodecahydro-1H-picene-2-carboxamide |
|---|---|
| PubChem CID | 87104858 |
| Molecular Formula | C34H56N2O3 |
| Molecular Weight | 540.83 g/mol |
| Exact Mass | 540.43 |
| IUPAC Name | (2S,4aS,6aR,6aS,6bR,10S,12aS,14bR)-10-amino-N-ethoxy-N-ethyl-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8a,10,11,12,14b-dodecahydro-1H-picene-2-carboxamide |
| SMILES | CCON(CC)C(=O)[C@@]1(C)CC[C@]2(C)CC[C@]3(C)C(=CC(=O)[C@@H]4[C@@]5(C)CC[C@H](N)C(C)(C)C5CC[C@]43C)[C@@H]2C1 |
| InChI | InChI=1S/C34H56N2O3/c1-10-36(39-11-2)28(38)31(6)17-16-30(5)18-19-33(8)22(23(30)21-31)20-24(37)27-32(7)14-13-26(35)29(3,4)25(32)12-15-34(27,33)9/h20,23,25-27H,10-19,21,35H2,1-9H3/t23-,25?,26-,27+,30+,31-,32-,33+,34+/m0/s1 |
| InChIKey | PVSUYQMJFSTLAY-CHXQUERKSA-N |
| XLogP | 7.09 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.83 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|