C26H52N2O3 — CID 87105651
(Z)-N-[1-(dimethylamino)propyl]octadec-9-enamide;propanoic acid (PubChem CID 87105651) has the molecular formula C26H52N2O3 and a molecular weight of 440.71 g/mol. Its IUPAC name is (Z)-N-[1-(dimethylamino)propyl]octadec-9-enamide;propanoic acid.
| Compound Name | (Z)-N-[1-(dimethylamino)propyl]octadec-9-enamide;propanoic acid |
|---|---|
| PubChem CID | 87105651 |
| Molecular Formula | C26H52N2O3 |
| Molecular Weight | 440.71 g/mol |
| Exact Mass | 440.40 |
| IUPAC Name | (Z)-N-[1-(dimethylamino)propyl]octadec-9-enamide;propanoic acid |
| SMILES | CCC(=O)O.CCCCCCCC/C=C\CCCCCCCC(=O)NC(CC)N(C)C |
| InChI | InChI=1S/C23H46N2O.C3H6O2/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23(26)24-22(6-2)25(3)4;1-2-3(4)5/h13-14,22H,5-12,15-21H2,1-4H3,(H,24,26);2H2,1H3,(H,4,5)/b14-13-; |
| InChIKey | OCXFUZKAOASSAG-HPWRNOGASA-N |
| XLogP | 6.92 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.71 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|