C12H11BrN2S — CID 87111668
5-bromo-2-phenyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine (PubChem CID 87111668) has the molecular formula C12H11BrN2S and a molecular weight of 295.20 g/mol. Its IUPAC name is 5-bromo-2-phenyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine.
| Compound Name | 5-bromo-2-phenyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine |
|---|---|
| PubChem CID | 87111668 |
| Molecular Formula | C12H11BrN2S |
| Molecular Weight | 295.20 g/mol |
| Exact Mass | 293.98 |
| IUPAC Name | 5-bromo-2-phenyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine |
| SMILES | BrN1CCc2nc(-c3ccccc3)sc2C1 |
| InChI | InChI=1S/C12H11BrN2S/c13-15-7-6-10-11(8-15)16-12(14-10)9-4-2-1-3-5-9/h1-5H,6-8H2 |
| InChIKey | XSCYEOVGTUMGRC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.20 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|