2-(2-ethyl-4-methylphenyl)butanoyl chloride

C13H17ClO — CID 87112263

IUPAC2-(2-ethyl-4-methylphenyl)butanoyl chloride
SMILESCCc1cc(C)ccc1C(CC)C(=O)Cl
InChIInChI=1S/C13H17ClO/c1-4-10-8-9(3)6-7-12(10)11(5-2)13(14)15/h6-8,11H,4-5H2,1-3H3
InChIKeyTVTQJLZHBYVPBR-UHFFFAOYSA-N
MW224.73 g/mol
LogP3.82
Rot. Bonds4

About 2-(2-ethyl-4-methylphenyl)butanoyl chloride

2-(2-ethyl-4-methylphenyl)butanoyl chloride (PubChem CID 87112263) has the molecular formula C13H17ClO and a molecular weight of 224.73 g/mol. Its IUPAC name is 2-(2-ethyl-4-methylphenyl)butanoyl chloride.

Molecular Properties

Compound Name2-(2-ethyl-4-methylphenyl)butanoyl chloride
PubChem CID87112263
Molecular FormulaC13H17ClO
Molecular Weight224.73 g/mol
Exact Mass224.10
IUPAC Name2-(2-ethyl-4-methylphenyl)butanoyl chloride
SMILESCCc1cc(C)ccc1C(CC)C(=O)Cl
InChIInChI=1S/C13H17ClO/c1-4-10-8-9(3)6-7-12(10)11(5-2)13(14)15/h6-8,11H,4-5H2,1-3H3
InChIKeyTVTQJLZHBYVPBR-UHFFFAOYSA-N
XLogP3.82
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.73
LogP ≤ 53.82
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2-(2-ethyl-4-methylphenyl)butanoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-ethyl-4-methylphenyl)butanoyl chloride?
The IUPAC name of 2-(2-ethyl-4-methylphenyl)butanoyl chloride (CID 87112263) is 2-(2-ethyl-4-methylphenyl)butanoyl chloride.
What is the SMILES notation for 2-(2-ethyl-4-methylphenyl)butanoyl chloride?
The canonical SMILES for 2-(2-ethyl-4-methylphenyl)butanoyl chloride is CCc1cc(C)ccc1C(CC)C(=O)Cl.
What is the InChIKey of 2-(2-ethyl-4-methylphenyl)butanoyl chloride?
The InChIKey is TVTQJLZHBYVPBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClO/c1-4-10-8-9(3)6-7-12(10)11(5-2)13(14)15/h6-8,11H,4-5H2,1-3H3.
What are the key properties of 2-(2-ethyl-4-methylphenyl)butanoyl chloride?
2-(2-ethyl-4-methylphenyl)butanoyl chloride has a molecular weight of 224.73 g/mol, XLogP of 3.82, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethyl-4-methylphenyl)butanoyl chloride is sourced from PubChem (CID 87112263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).