C30H30FN2O5+ — CID 87114893
(2S,6S)-1-benzyl-2-(cyanomethyl)-6-[4-[(2-fluorophenyl)methoxy]phenyl]-2-methoxycarbonylpiperidin-1-ium-1-carboxylic acid (PubChem CID 87114893) has the molecular formula C30H30FN2O5+ and a molecular weight of 517.58 g/mol. Its IUPAC name is (2S,6S)-1-benzyl-2-(cyanomethyl)-6-[4-[(2-fluorophenyl)methoxy]phenyl]-2-methoxycarbonylpiperidin-1-ium-1-carboxylic acid.
| Compound Name | (2S,6S)-1-benzyl-2-(cyanomethyl)-6-[4-[(2-fluorophenyl)methoxy]phenyl]-2-methoxycarbonylpiperidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 87114893 |
| Molecular Formula | C30H30FN2O5+ |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 517.21 |
| IUPAC Name | (2S,6S)-1-benzyl-2-(cyanomethyl)-6-[4-[(2-fluorophenyl)methoxy]phenyl]-2-methoxycarbonylpiperidin-1-ium-1-carboxylic acid |
| SMILES | COC(=O)[C@@]1(CC#N)CCC[C@@H](c2ccc(OCc3ccccc3F)cc2)[N+]1(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C30H29FN2O5/c1-37-28(34)30(18-19-32)17-7-12-27(33(30,29(35)36)20-22-8-3-2-4-9-22)23-13-15-25(16-14-23)38-21-24-10-5-6-11-26(24)31/h2-6,8-11,13-16,27H,7,12,17-18,20-21H2,1H3/p+1/t27-,30-,33?/m0/s1 |
| InChIKey | HPKNYEGXQLBKAB-HVJPSALPSA-O |
| XLogP | 6.15 |
| TPSA | 96.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|