C24H29FNO5+ — CID 87090165
(2S,5R)-1-tert-butyl-5-[4-[(2-fluorophenyl)methoxy]phenyl]-2-methylpyrrolidin-1-ium-1,2-dicarboxylic acid (PubChem CID 87090165) has the molecular formula C24H29FNO5+ and a molecular weight of 430.50 g/mol. Its IUPAC name is (2S,5R)-1-tert-butyl-5-[4-[(2-fluorophenyl)methoxy]phenyl]-2-methylpyrrolidin-1-ium-1,2-dicarboxylic acid.
| Compound Name | (2S,5R)-1-tert-butyl-5-[4-[(2-fluorophenyl)methoxy]phenyl]-2-methylpyrrolidin-1-ium-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 87090165 |
| Molecular Formula | C24H29FNO5+ |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | (2S,5R)-1-tert-butyl-5-[4-[(2-fluorophenyl)methoxy]phenyl]-2-methylpyrrolidin-1-ium-1,2-dicarboxylic acid |
| SMILES | CC(C)(C)[N+]1(C(=O)O)[C@@H](c2ccc(OCc3ccccc3F)cc2)CC[C@@]1(C)C(=O)O |
| InChI | InChI=1S/C24H28FNO5/c1-23(2,3)26(22(29)30)20(13-14-24(26,4)21(27)28)16-9-11-18(12-10-16)31-15-17-7-5-6-8-19(17)25/h5-12,20H,13-15H2,1-4H3,(H-,27,28,29,30)/p+1/t20-,24+,26?/m1/s1 |
| InChIKey | NCIHYTXORVXDHB-LLHWJCAFSA-O |
| XLogP | 5.38 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|