About 4-ethyltetradecanedioyl dichloride
4-ethyltetradecanedioyl dichloride (PubChem CID 87116546) has the molecular formula C16H28Cl2O2
and a molecular weight of 323.30 g/mol. Its IUPAC name is 4-ethyltetradecanedioyl dichloride.
Molecular Properties
| Compound Name | 4-ethyltetradecanedioyl dichloride |
| PubChem CID | 87116546 |
| Molecular Formula | C16H28Cl2O2 |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 4-ethyltetradecanedioyl dichloride |
| SMILES | CCC(CCCCCCCCCC(=O)Cl)CCC(=O)Cl |
| InChI | InChI=1S/C16H28Cl2O2/c1-2-14(12-13-16(18)20)10-8-6-4-3-5-7-9-11-15(17)19/h14H,2-13H2,1H3 |
| InChIKey | SRFKYISLSTYSQD-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyltetradecanedioyl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyltetradecanedioyl dichloride?
The IUPAC name of 4-ethyltetradecanedioyl dichloride (CID 87116546) is 4-ethyltetradecanedioyl dichloride.
What is the SMILES notation for 4-ethyltetradecanedioyl dichloride?
The canonical SMILES for 4-ethyltetradecanedioyl dichloride is CCC(CCCCCCCCCC(=O)Cl)CCC(=O)Cl.
What is the InChIKey of 4-ethyltetradecanedioyl dichloride?
The InChIKey is SRFKYISLSTYSQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28Cl2O2/c1-2-14(12-13-16(18)20)10-8-6-4-3-5-7-9-11-15(17)19/h14H,2-13H2,1H3.
What are the key properties of 4-ethyltetradecanedioyl dichloride?
4-ethyltetradecanedioyl dichloride has a molecular weight of 323.30 g/mol, XLogP of 5.83, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyltetradecanedioyl dichloride is sourced from PubChem (CID 87116546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).