About azanium;2-(2-hydroxyethylamino)ethanol;carbamodithioate
azanium;2-(2-hydroxyethylamino)ethanol;carbamodithioate (PubChem CID 87118070) has the molecular formula C5H17N3O2S2
and a molecular weight of 215.34 g/mol. Its IUPAC name is azanium;2-(2-hydroxyethylamino)ethanol;carbamodithioate.
Molecular Properties
| Compound Name | azanium;2-(2-hydroxyethylamino)ethanol;carbamodithioate |
| PubChem CID | 87118070 |
| Molecular Formula | C5H17N3O2S2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | azanium;2-(2-hydroxyethylamino)ethanol;carbamodithioate |
| SMILES | NC(=S)[S-].OCCNCCO.[NH4+] |
| InChI | InChI=1S/C4H11NO2.CH3NS2.H3N/c6-3-1-5-2-4-7;2-1(3)4;/h5-7H,1-4H2;(H3,2,3,4);1H3 |
| InChIKey | SXUWZYPCGUBNGN-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 115.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze azanium;2-(2-hydroxyethylamino)ethanol;carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium;2-(2-hydroxyethylamino)ethanol;carbamodithioate?
The IUPAC name of azanium;2-(2-hydroxyethylamino)ethanol;carbamodithioate (CID 87118070) is azanium;2-(2-hydroxyethylamino)ethanol;carbamodithioate.
What is the SMILES notation for azanium;2-(2-hydroxyethylamino)ethanol;carbamodithioate?
The canonical SMILES for azanium;2-(2-hydroxyethylamino)ethanol;carbamodithioate is NC(=S)[S-].OCCNCCO.[NH4+].
What is the InChIKey of azanium;2-(2-hydroxyethylamino)ethanol;carbamodithioate?
The InChIKey is SXUWZYPCGUBNGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11NO2.CH3NS2.H3N/c6-3-1-5-2-4-7;2-1(3)4;/h5-7H,1-4H2;(H3,2,3,4);1H3.
What are the key properties of azanium;2-(2-hydroxyethylamino)ethanol;carbamodithioate?
azanium;2-(2-hydroxyethylamino)ethanol;carbamodithioate has a molecular weight of 215.34 g/mol, XLogP of -1.29, 4 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azanium;2-(2-hydroxyethylamino)ethanol;carbamodithioate is sourced from PubChem (CID 87118070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).