C19H24BrN3O3 — CID 87122007
2-(3-bromo-8-methylquinolin-6-yl)oxy-N-[(1E)-1-methoxyimino-2-methylpropan-2-yl]butanamide (PubChem CID 87122007) has the molecular formula C19H24BrN3O3 and a molecular weight of 422.32 g/mol. Its IUPAC name is 2-(3-bromo-8-methylquinolin-6-yl)oxy-N-[(1E)-1-methoxyimino-2-methylpropan-2-yl]butanamide.
| Compound Name | 2-(3-bromo-8-methylquinolin-6-yl)oxy-N-[(1E)-1-methoxyimino-2-methylpropan-2-yl]butanamide |
|---|---|
| PubChem CID | 87122007 |
| Molecular Formula | C19H24BrN3O3 |
| Molecular Weight | 422.32 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 2-(3-bromo-8-methylquinolin-6-yl)oxy-N-[(1E)-1-methoxyimino-2-methylpropan-2-yl]butanamide |
| SMILES | CCC(Oc1cc(C)c2ncc(Br)cc2c1)C(=O)NC(C)(C)/C=N/OC |
| InChI | InChI=1S/C19H24BrN3O3/c1-6-16(18(24)23-19(3,4)11-22-25-5)26-15-7-12(2)17-13(9-15)8-14(20)10-21-17/h7-11,16H,6H2,1-5H3,(H,23,24)/b22-11+ |
| InChIKey | HPZZGGCUFHWWFI-SSDVNMTOSA-N |
| XLogP | 3.99 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.32 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|