C24H23BrCl3N3O2S — CID 141233123
2-(3-bromo-8-methylquinolin-6-yl)oxy-N-[2-methyl-1-[(2,4,5-trichlorophenyl)methoxyimino]propan-2-yl]propanethioamide (PubChem CID 141233123) has the molecular formula C24H23BrCl3N3O2S and a molecular weight of 603.80 g/mol. Its IUPAC name is 2-(3-bromo-8-methylquinolin-6-yl)oxy-N-[2-methyl-1-[(2,4,5-trichlorophenyl)methoxyimino]propan-2-yl]propanethioamide.
| Compound Name | 2-(3-bromo-8-methylquinolin-6-yl)oxy-N-[2-methyl-1-[(2,4,5-trichlorophenyl)methoxyimino]propan-2-yl]propanethioamide |
|---|---|
| PubChem CID | 141233123 |
| Molecular Formula | C24H23BrCl3N3O2S |
| Molecular Weight | 603.80 g/mol |
| Exact Mass | 600.98 |
| IUPAC Name | 2-(3-bromo-8-methylquinolin-6-yl)oxy-N-[2-methyl-1-[(2,4,5-trichlorophenyl)methoxyimino]propan-2-yl]propanethioamide |
| SMILES | Cc1cc(OC(C)C(=S)NC(C)(C)C=NOCc2cc(Cl)c(Cl)cc2Cl)cc2cc(Br)cnc12 |
| InChI | InChI=1S/C24H23BrCl3N3O2S/c1-13-5-18(7-15-6-17(25)10-29-22(13)15)33-14(2)23(34)31-24(3,4)12-30-32-11-16-8-20(27)21(28)9-19(16)26/h5-10,12,14H,11H2,1-4H3,(H,31,34) |
| InChIKey | NSCSCFAGZKFMGZ-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 55.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.80 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|