C18H21BrFN3O3S — CID 91610849
2-(3-bromoquinolin-6-yl)oxy-N-[1-(2-fluoroethoxyimino)-2-methylpropan-2-yl]-2-methylsulfanylacetamide (PubChem CID 91610849) has the molecular formula C18H21BrFN3O3S and a molecular weight of 458.35 g/mol. Its IUPAC name is 2-(3-bromoquinolin-6-yl)oxy-N-[1-(2-fluoroethoxyimino)-2-methylpropan-2-yl]-2-methylsulfanylacetamide.
| Compound Name | 2-(3-bromoquinolin-6-yl)oxy-N-[1-(2-fluoroethoxyimino)-2-methylpropan-2-yl]-2-methylsulfanylacetamide |
|---|---|
| PubChem CID | 91610849 |
| Molecular Formula | C18H21BrFN3O3S |
| Molecular Weight | 458.35 g/mol |
| Exact Mass | 457.05 |
| IUPAC Name | 2-(3-bromoquinolin-6-yl)oxy-N-[1-(2-fluoroethoxyimino)-2-methylpropan-2-yl]-2-methylsulfanylacetamide |
| SMILES | CSC(Oc1ccc2ncc(Br)cc2c1)C(=O)NC(C)(C)C=NOCCF |
| InChI | InChI=1S/C18H21BrFN3O3S/c1-18(2,11-22-25-7-6-20)23-16(24)17(27-3)26-14-4-5-15-12(9-14)8-13(19)10-21-15/h4-5,8-11,17H,6-7H2,1-3H3,(H,23,24) |
| InChIKey | DVTWPIWTRSRTQK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.35 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|