C16H19BrN2O3 — CID 68715311
2-(3-bromoquinolin-6-yl)oxy-N-tert-butyl-2-methoxyacetamide (PubChem CID 68715311) has the molecular formula C16H19BrN2O3 and a molecular weight of 367.24 g/mol. Its IUPAC name is 2-(3-bromoquinolin-6-yl)oxy-N-tert-butyl-2-methoxyacetamide.
| Compound Name | 2-(3-bromoquinolin-6-yl)oxy-N-tert-butyl-2-methoxyacetamide |
|---|---|
| PubChem CID | 68715311 |
| Molecular Formula | C16H19BrN2O3 |
| Molecular Weight | 367.24 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 2-(3-bromoquinolin-6-yl)oxy-N-tert-butyl-2-methoxyacetamide |
| SMILES | COC(Oc1ccc2ncc(Br)cc2c1)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C16H19BrN2O3/c1-16(2,3)19-14(20)15(21-4)22-12-5-6-13-10(8-12)7-11(17)9-18-13/h5-9,15H,1-4H3,(H,19,20) |
| InChIKey | OIZSJMZGXKLPQV-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.24 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|