C15H16BrN3O2S — CID 141233110
2-(3-bromoquinolin-6-yl)oxy-N-(2-methoxyiminoethyl)propanethioamide (PubChem CID 141233110) has the molecular formula C15H16BrN3O2S and a molecular weight of 382.28 g/mol. Its IUPAC name is 2-(3-bromoquinolin-6-yl)oxy-N-(2-methoxyiminoethyl)propanethioamide.
| Compound Name | 2-(3-bromoquinolin-6-yl)oxy-N-(2-methoxyiminoethyl)propanethioamide |
|---|---|
| PubChem CID | 141233110 |
| Molecular Formula | C15H16BrN3O2S |
| Molecular Weight | 382.28 g/mol |
| Exact Mass | 381.01 |
| IUPAC Name | 2-(3-bromoquinolin-6-yl)oxy-N-(2-methoxyiminoethyl)propanethioamide |
| SMILES | CON=CCNC(=S)C(C)Oc1ccc2ncc(Br)cc2c1 |
| InChI | InChI=1S/C15H16BrN3O2S/c1-10(15(22)17-5-6-19-20-2)21-13-3-4-14-11(8-13)7-12(16)9-18-14/h3-4,6-10H,5H2,1-2H3,(H,17,22) |
| InChIKey | VLHJZGXIEHSARZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 55.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.28 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|