C17H20BrN3O4S — CID 140557262
2-[(3-bromo-2-oxo-1H-quinolin-6-yl)oxy]-N-[(1E)-1-methoxyimino-2-methylpropan-2-yl]-2-methylsulfanylacetamide (PubChem CID 140557262) has the molecular formula C17H20BrN3O4S and a molecular weight of 442.34 g/mol. Its IUPAC name is 2-[(3-bromo-2-oxo-1H-quinolin-6-yl)oxy]-N-[(1E)-1-methoxyimino-2-methylpropan-2-yl]-2-methylsulfanylacetamide.
| Compound Name | 2-[(3-bromo-2-oxo-1H-quinolin-6-yl)oxy]-N-[(1E)-1-methoxyimino-2-methylpropan-2-yl]-2-methylsulfanylacetamide |
|---|---|
| PubChem CID | 140557262 |
| Molecular Formula | C17H20BrN3O4S |
| Molecular Weight | 442.34 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | 2-[(3-bromo-2-oxo-1H-quinolin-6-yl)oxy]-N-[(1E)-1-methoxyimino-2-methylpropan-2-yl]-2-methylsulfanylacetamide |
| SMILES | CO/N=C/C(C)(C)NC(=O)C(Oc1ccc2[nH]c(=O)c(Br)cc2c1)SC |
| InChI | InChI=1S/C17H20BrN3O4S/c1-17(2,9-19-24-3)21-15(23)16(26-4)25-11-5-6-13-10(7-11)8-12(18)14(22)20-13/h5-9,16H,1-4H3,(H,20,22)(H,21,23)/b19-9+ |
| InChIKey | PHESDMPOIHEYJG-DJKKODMXSA-N |
| XLogP | 2.89 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|