C15H19N3O3S2 — CID 87551295
2-(1,3-benzothiazol-6-yloxy)-N-[(1E)-1-methoxyimino-2-methylpropan-2-yl]-2-methylsulfanylacetamide (PubChem CID 87551295) has the molecular formula C15H19N3O3S2 and a molecular weight of 353.47 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-6-yloxy)-N-[(1E)-1-methoxyimino-2-methylpropan-2-yl]-2-methylsulfanylacetamide.
| Compound Name | 2-(1,3-benzothiazol-6-yloxy)-N-[(1E)-1-methoxyimino-2-methylpropan-2-yl]-2-methylsulfanylacetamide |
|---|---|
| PubChem CID | 87551295 |
| Molecular Formula | C15H19N3O3S2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 2-(1,3-benzothiazol-6-yloxy)-N-[(1E)-1-methoxyimino-2-methylpropan-2-yl]-2-methylsulfanylacetamide |
| SMILES | CO/N=C/C(C)(C)NC(=O)C(Oc1ccc2ncsc2c1)SC |
| InChI | InChI=1S/C15H19N3O3S2/c1-15(2,8-17-20-3)18-13(19)14(22-4)21-10-5-6-11-12(7-10)23-9-16-11/h5-9,14H,1-4H3,(H,18,19)/b17-8+ |
| InChIKey | ZTOJTXCVFOEIKJ-CAOOACKPSA-N |
| XLogP | 2.89 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|