C18H23BrN2OS — CID 135030177
3-(3-bromo-8-methylquinolin-6-yl)-N-tert-butyl-2-methylsulfanylpropanamide (PubChem CID 135030177) has the molecular formula C18H23BrN2OS and a molecular weight of 395.37 g/mol. Its IUPAC name is 3-(3-bromo-8-methylquinolin-6-yl)-N-tert-butyl-2-methylsulfanylpropanamide.
| Compound Name | 3-(3-bromo-8-methylquinolin-6-yl)-N-tert-butyl-2-methylsulfanylpropanamide |
|---|---|
| PubChem CID | 135030177 |
| Molecular Formula | C18H23BrN2OS |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 3-(3-bromo-8-methylquinolin-6-yl)-N-tert-butyl-2-methylsulfanylpropanamide |
| SMILES | CSC(Cc1cc(C)c2ncc(Br)cc2c1)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C18H23BrN2OS/c1-11-6-12(7-13-9-14(19)10-20-16(11)13)8-15(23-5)17(22)21-18(2,3)4/h6-7,9-10,15H,8H2,1-5H3,(H,21,22) |
| InChIKey | CFGLTFXJBZOZIK-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |