C35H45NO14S — CID 87122292
[[3-hydroxy-2-methyl-6-[[(1S,3S)-3,5,12-trihydroxy-3-(2-hydroxyacetyl)-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]oxan-4-yl]amino] octane-1-sulfonate (PubChem CID 87122292) has the molecular formula C35H45NO14S and a molecular weight of 735.80 g/mol. Its IUPAC name is [[3-hydroxy-2-methyl-6-[[(1S,3S)-3,5,12-trihydroxy-3-(2-hydroxyacetyl)-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]oxan-4-yl]amino] octane-1-sulfonate.
| Compound Name | [[3-hydroxy-2-methyl-6-[[(1S,3S)-3,5,12-trihydroxy-3-(2-hydroxyacetyl)-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]oxan-4-yl]amino] octane-1-sulfonate |
|---|---|
| PubChem CID | 87122292 |
| Molecular Formula | C35H45NO14S |
| Molecular Weight | 735.80 g/mol |
| Exact Mass | 735.26 |
| IUPAC Name | [[3-hydroxy-2-methyl-6-[[(1S,3S)-3,5,12-trihydroxy-3-(2-hydroxyacetyl)-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]oxan-4-yl]amino] octane-1-sulfonate |
| SMILES | CCCCCCCCS(=O)(=O)ONC1CC(O[C@H]2C[C@](O)(C(=O)CO)Cc3c(O)c4c(c(O)c32)C(=O)c2c(OC)cccc2C4=O)OC(C)C1O |
| InChI | InChI=1S/C35H45NO14S/c1-4-5-6-7-8-9-13-51(45,46)50-36-21-14-25(48-18(2)30(21)39)49-23-16-35(44,24(38)17-37)15-20-27(23)34(43)29-28(32(20)41)31(40)19-11-10-12-22(47-3)26(19)33(29)42/h10-12,18,21,23,25,30,36-37,39,41,43-44H,4-9,13-17H2,1-3H3/t18?,21?,23-,25?,30?,35-/m0/s1 |
| InChIKey | VRVXHZLAEKXAAD-HFBAMPEWSA-N |
| XLogP | 2.25 |
| TPSA | 235.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.80 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|