C13H24O6S2 — CID 87124231
1,1-bis(butylsulfonyl)pentane-2,3-dione (PubChem CID 87124231) has the molecular formula C13H24O6S2 and a molecular weight of 340.46 g/mol. Its IUPAC name is 1,1-bis(butylsulfonyl)pentane-2,3-dione.
| Compound Name | 1,1-bis(butylsulfonyl)pentane-2,3-dione |
|---|---|
| PubChem CID | 87124231 |
| Molecular Formula | C13H24O6S2 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 1,1-bis(butylsulfonyl)pentane-2,3-dione |
| SMILES | CCCCS(=O)(=O)C(C(=O)C(=O)CC)S(=O)(=O)CCCC |
| InChI | InChI=1S/C13H24O6S2/c1-4-7-9-20(16,17)13(12(15)11(14)6-3)21(18,19)10-8-5-2/h13H,4-10H2,1-3H3 |
| InChIKey | RNVCTWVIPOEPMO-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|