C23H33N2O7PS — CID 87127080
ethoxy-[ethyl-[6-[(4-phenoxyphenyl)sulfonylamino]hexyl]carbamoyl]phosphinic acid (PubChem CID 87127080) has the molecular formula C23H33N2O7PS and a molecular weight of 512.57 g/mol. Its IUPAC name is ethoxy-[ethyl-[6-[(4-phenoxyphenyl)sulfonylamino]hexyl]carbamoyl]phosphinic acid.
| Compound Name | ethoxy-[ethyl-[6-[(4-phenoxyphenyl)sulfonylamino]hexyl]carbamoyl]phosphinic acid |
|---|---|
| PubChem CID | 87127080 |
| Molecular Formula | C23H33N2O7PS |
| Molecular Weight | 512.57 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | ethoxy-[ethyl-[6-[(4-phenoxyphenyl)sulfonylamino]hexyl]carbamoyl]phosphinic acid |
| SMILES | CCOP(=O)(O)C(=O)N(CC)CCCCCCNS(=O)(=O)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C23H33N2O7PS/c1-3-25(23(26)33(27,28)31-4-2)19-11-6-5-10-18-24-34(29,30)22-16-14-21(15-17-22)32-20-12-8-7-9-13-20/h7-9,12-17,24H,3-6,10-11,18-19H2,1-2H3,(H,27,28) |
| InChIKey | LKUIBKGPMNERGH-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.57 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|