C17H22N3O7PS — CID 46865154
2-[2-[(4-phenoxyphenyl)sulfonylamino]ethylamino]ethylcarbamoylphosphonic acid (PubChem CID 46865154) has the molecular formula C17H22N3O7PS and a molecular weight of 443.42 g/mol. Its IUPAC name is 2-[2-[(4-phenoxyphenyl)sulfonylamino]ethylamino]ethylcarbamoylphosphonic acid.
| Compound Name | 2-[2-[(4-phenoxyphenyl)sulfonylamino]ethylamino]ethylcarbamoylphosphonic acid |
|---|---|
| PubChem CID | 46865154 |
| Molecular Formula | C17H22N3O7PS |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | 2-[2-[(4-phenoxyphenyl)sulfonylamino]ethylamino]ethylcarbamoylphosphonic acid |
| SMILES | O=C(NCCNCCNS(=O)(=O)c1ccc(Oc2ccccc2)cc1)P(=O)(O)O |
| InChI | InChI=1S/C17H22N3O7PS/c21-17(28(22,23)24)19-12-10-18-11-13-20-29(25,26)16-8-6-15(7-9-16)27-14-4-2-1-3-5-14/h1-9,18,20H,10-13H2,(H,19,21)(H2,22,23,24) |
| InChIKey | IVMUEELRNYGGRV-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 154.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|