C16H20N3O7PS — CID 46865260
[(2R)-2-amino-3-[(4-phenoxyphenyl)sulfonylamino]propyl]carbamoylphosphonic acid (PubChem CID 46865260) has the molecular formula C16H20N3O7PS and a molecular weight of 429.39 g/mol. Its IUPAC name is [(2R)-2-amino-3-[(4-phenoxyphenyl)sulfonylamino]propyl]carbamoylphosphonic acid.
| Compound Name | [(2R)-2-amino-3-[(4-phenoxyphenyl)sulfonylamino]propyl]carbamoylphosphonic acid |
|---|---|
| PubChem CID | 46865260 |
| Molecular Formula | C16H20N3O7PS |
| Molecular Weight | 429.39 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | [(2R)-2-amino-3-[(4-phenoxyphenyl)sulfonylamino]propyl]carbamoylphosphonic acid |
| SMILES | N[C@H](CNC(=O)P(=O)(O)O)CNS(=O)(=O)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C16H20N3O7PS/c17-12(10-18-16(20)27(21,22)23)11-19-28(24,25)15-8-6-14(7-9-15)26-13-4-2-1-3-5-13/h1-9,12,19H,10-11,17H2,(H,18,20)(H2,21,22,23)/t12-/m1/s1 |
| InChIKey | NIIGYLADEADHLF-GFCCVEGCSA-N |
| XLogP | 0.97 |
| TPSA | 168.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.39 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|