C30H40N3O8PS — CID 87126886
1-di(propan-2-yloxy)phosphoryl-N-[(2S)-2-[methyl(phenylmethoxy)amino]-3-[(4-phenoxyphenyl)sulfonylamino]propyl]formamide (PubChem CID 87126886) has the molecular formula C30H40N3O8PS and a molecular weight of 633.70 g/mol. Its IUPAC name is 1-di(propan-2-yloxy)phosphoryl-N-[(2S)-2-[methyl(phenylmethoxy)amino]-3-[(4-phenoxyphenyl)sulfonylamino]propyl]formamide.
| Compound Name | 1-di(propan-2-yloxy)phosphoryl-N-[(2S)-2-[methyl(phenylmethoxy)amino]-3-[(4-phenoxyphenyl)sulfonylamino]propyl]formamide |
|---|---|
| PubChem CID | 87126886 |
| Molecular Formula | C30H40N3O8PS |
| Molecular Weight | 633.70 g/mol |
| Exact Mass | 633.23 |
| IUPAC Name | 1-di(propan-2-yloxy)phosphoryl-N-[(2S)-2-[methyl(phenylmethoxy)amino]-3-[(4-phenoxyphenyl)sulfonylamino]propyl]formamide |
| SMILES | CC(C)OP(=O)(OC(C)C)C(=O)NC[C@@H](CNS(=O)(=O)c1ccc(Oc2ccccc2)cc1)N(C)OCc1ccccc1 |
| InChI | InChI=1S/C30H40N3O8PS/c1-23(2)40-42(35,41-24(3)4)30(34)31-20-26(33(5)38-22-25-12-8-6-9-13-25)21-32-43(36,37)29-18-16-28(17-19-29)39-27-14-10-7-11-15-27/h6-19,23-24,26,32H,20-22H2,1-5H3,(H,31,34)/t26-/m0/s1 |
| InChIKey | NSXGKVZNGJNBMY-SANMLTNESA-N |
| XLogP | 5.94 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.70 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|