C15H12ClN5O2 — CID 87127490
3-[(2-chloro-5-nitro-4-pyridinyl)amino]-1-pyridin-2-ylcyclobutane-1-carbonitrile (PubChem CID 87127490) has the molecular formula C15H12ClN5O2 and a molecular weight of 329.75 g/mol. Its IUPAC name is 3-[(2-chloro-5-nitro-4-pyridinyl)amino]-1-pyridin-2-ylcyclobutane-1-carbonitrile.
| Compound Name | 3-[(2-chloro-5-nitro-4-pyridinyl)amino]-1-pyridin-2-ylcyclobutane-1-carbonitrile |
|---|---|
| PubChem CID | 87127490 |
| Molecular Formula | C15H12ClN5O2 |
| Molecular Weight | 329.75 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 3-[(2-chloro-5-nitro-4-pyridinyl)amino]-1-pyridin-2-ylcyclobutane-1-carbonitrile |
| SMILES | N#CC1(c2ccccn2)CC(Nc2cc(Cl)ncc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C15H12ClN5O2/c16-14-5-11(12(8-19-14)21(22)23)20-10-6-15(7-10,9-17)13-3-1-2-4-18-13/h1-5,8,10H,6-7H2,(H,19,20) |
| InChIKey | LPRWSWRVDNAROE-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 104.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.75 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|