C25H29ClN6O2 — CID 3066636
N-[2-[4-[(4-chlorophenyl)-pyridin-4-ylmethyl]piperazin-1-yl]ethyl]-2,6-dimethyl-3-nitropyridin-4-amine (PubChem CID 3066636) has the molecular formula C25H29ClN6O2 and a molecular weight of 481.00 g/mol. Its IUPAC name is N-[2-[4-[(4-chlorophenyl)-pyridin-4-ylmethyl]piperazin-1-yl]ethyl]-2,6-dimethyl-3-nitropyridin-4-amine.
| Compound Name | N-[2-[4-[(4-chlorophenyl)-pyridin-4-ylmethyl]piperazin-1-yl]ethyl]-2,6-dimethyl-3-nitropyridin-4-amine |
|---|---|
| PubChem CID | 3066636 |
| Molecular Formula | C25H29ClN6O2 |
| Molecular Weight | 481.00 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | N-[2-[4-[(4-chlorophenyl)-pyridin-4-ylmethyl]piperazin-1-yl]ethyl]-2,6-dimethyl-3-nitropyridin-4-amine |
| SMILES | Cc1cc(NCCN2CCN(C(c3ccncc3)c3ccc(Cl)cc3)CC2)c([N+](=O)[O-])c(C)n1 |
| InChI | InChI=1S/C25H29ClN6O2/c1-18-17-23(24(32(33)34)19(2)29-18)28-11-12-30-13-15-31(16-14-30)25(21-7-9-27-10-8-21)20-3-5-22(26)6-4-20/h3-10,17,25H,11-16H2,1-2H3,(H,28,29) |
| InChIKey | RRIVQIWERPDKEG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 87.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.00 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|