C21H23Cl2N9O2 — CID 18334985
6-N-[2-[[4-(2,4-dichlorophenyl)-5-piperazin-1-ylpyrimidin-2-yl]amino]ethyl]-3-nitropyridine-2,6-diamine (PubChem CID 18334985) has the molecular formula C21H23Cl2N9O2 and a molecular weight of 504.38 g/mol. Its IUPAC name is 6-N-[2-[[4-(2,4-dichlorophenyl)-5-piperazin-1-ylpyrimidin-2-yl]amino]ethyl]-3-nitropyridine-2,6-diamine.
| Compound Name | 6-N-[2-[[4-(2,4-dichlorophenyl)-5-piperazin-1-ylpyrimidin-2-yl]amino]ethyl]-3-nitropyridine-2,6-diamine |
|---|---|
| PubChem CID | 18334985 |
| Molecular Formula | C21H23Cl2N9O2 |
| Molecular Weight | 504.38 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | 6-N-[2-[[4-(2,4-dichlorophenyl)-5-piperazin-1-ylpyrimidin-2-yl]amino]ethyl]-3-nitropyridine-2,6-diamine |
| SMILES | Nc1nc(NCCNc2ncc(N3CCNCC3)c(-c3ccc(Cl)cc3Cl)n2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H23Cl2N9O2/c22-13-1-2-14(15(23)11-13)19-17(31-9-7-25-8-10-31)12-28-21(30-19)27-6-5-26-18-4-3-16(32(33)34)20(24)29-18/h1-4,11-12,25H,5-10H2,(H3,24,26,29)(H,27,28,30) |
| InChIKey | TVAYDTMVNRIGOO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 147.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.38 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|