C6H15N2O4P — CID 87127764
[(2S,3S)-3-acetamido-4-hydroxybutan-2-yl]oxyphosphonamidous acid (PubChem CID 87127764) has the molecular formula C6H15N2O4P and a molecular weight of 210.17 g/mol. Its IUPAC name is [(2S,3S)-3-acetamido-4-hydroxybutan-2-yl]oxyphosphonamidous acid.
| Compound Name | [(2S,3S)-3-acetamido-4-hydroxybutan-2-yl]oxyphosphonamidous acid |
|---|---|
| PubChem CID | 87127764 |
| Molecular Formula | C6H15N2O4P |
| Molecular Weight | 210.17 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | [(2S,3S)-3-acetamido-4-hydroxybutan-2-yl]oxyphosphonamidous acid |
| SMILES | CC(=O)N[C@@H](CO)[C@H](C)OP(N)O |
| InChI | InChI=1S/C6H15N2O4P/c1-4(12-13(7)11)6(3-9)8-5(2)10/h4,6,9,11H,3,7H2,1-2H3,(H,8,10)/t4-,6-,13?/m0/s1 |
| InChIKey | IASSCPKPRZTJEZ-CNCMXLSGSA-N |
| XLogP | -0.93 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.17 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|