C10H20F3O2P — CID 87128383
1-[butyl(2,2,2-trifluoroethyl)phosphoryl]oxybutane (PubChem CID 87128383) has the molecular formula C10H20F3O2P and a molecular weight of 260.24 g/mol. Its IUPAC name is 1-[butyl(2,2,2-trifluoroethyl)phosphoryl]oxybutane.
| Compound Name | 1-[butyl(2,2,2-trifluoroethyl)phosphoryl]oxybutane |
|---|---|
| PubChem CID | 87128383 |
| Molecular Formula | C10H20F3O2P |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 1-[butyl(2,2,2-trifluoroethyl)phosphoryl]oxybutane |
| SMILES | CCCCOP(=O)(CCCC)CC(F)(F)F |
| InChI | InChI=1S/C10H20F3O2P/c1-3-5-7-15-16(14,8-6-4-2)9-10(11,12)13/h3-9H2,1-2H3 |
| InChIKey | PIEDXQPYLYHQRE-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|