About 2-aminobenzenethiol
2-aminobenzenethiol (PubChem CID 8713) has the molecular formula C6H7NS
and a molecular weight of 125.20 g/mol. Its IUPAC name is 2-aminobenzenethiol.
Molecular Properties
| Compound Name | 2-aminobenzenethiol |
| PubChem CID | 8713 |
| Molecular Formula | C6H7NS |
| Molecular Weight | 125.20 g/mol |
| Exact Mass | 125.03 |
| IUPAC Name | 2-aminobenzenethiol |
| SMILES | Nc1ccccc1S |
| InChI | InChI=1S/C6H7NS/c7-5-3-1-2-4-6(5)8/h1-4,8H,7H2 |
| InChIKey | VRVRGVPWCUEOGV-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.20 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-aminobenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobenzenethiol?
The IUPAC name of 2-aminobenzenethiol (CID 8713) is 2-aminobenzenethiol.
What is the SMILES notation for 2-aminobenzenethiol?
The canonical SMILES for 2-aminobenzenethiol is Nc1ccccc1S.
What is the InChIKey of 2-aminobenzenethiol?
The InChIKey is VRVRGVPWCUEOGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NS/c7-5-3-1-2-4-6(5)8/h1-4,8H,7H2.
What are the key properties of 2-aminobenzenethiol?
2-aminobenzenethiol has a molecular weight of 125.20 g/mol, XLogP of 1.56, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobenzenethiol is sourced from PubChem (CID 8713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).