About 2-(Methylthio)aniline
2-(Methylthio)aniline (PubChem CID 76337) has the molecular formula C7H9NS
and a molecular weight of 139.22 g/mol. Its IUPAC name is 2-methylsulfanylaniline.
Molecular Properties
| Compound Name | 2-(Methylthio)aniline |
| PubChem CID | 76337 |
| Molecular Formula | C7H9NS |
| Molecular Weight | 139.22 g/mol |
| Exact Mass | 139.05 |
| IUPAC Name | 2-methylsulfanylaniline |
| SMILES | CSC1=CC=CC=C1N |
| InChI | InChI=1S/C7H9NS/c1-9-7-5-3-2-4-6(7)8/h2-5H,8H2,1H3 |
| InChIKey | WBRPQQSADOCKCH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 51.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | 85 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.22 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(Methylthio)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(Methylthio)aniline?
The IUPAC name of 2-(Methylthio)aniline (CID 76337) is 2-methylsulfanylaniline.
What is the SMILES notation for 2-(Methylthio)aniline?
The canonical SMILES for 2-(Methylthio)aniline is CSC1=CC=CC=C1N.
What is the InChIKey of 2-(Methylthio)aniline?
The InChIKey is WBRPQQSADOCKCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NS/c1-9-7-5-3-2-4-6(7)8/h2-5H,8H2,1H3.
What are the key properties of 2-(Methylthio)aniline?
2-(Methylthio)aniline has a molecular weight of 139.22 g/mol, XLogP of 1.80, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(Methylthio)aniline is sourced from PubChem (CID 76337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).