About 2-methoxybenzaldehyde;2-oxabicyclo[2.1.0]pentane
2-methoxybenzaldehyde;2-oxabicyclo[2.1.0]pentane (PubChem CID 87135662) has the molecular formula C12H14O3
and a molecular weight of 206.24 g/mol. Its IUPAC name is 2-methoxybenzaldehyde;2-oxabicyclo[2.1.0]pentane.
Molecular Properties
| Compound Name | 2-methoxybenzaldehyde;2-oxabicyclo[2.1.0]pentane |
| PubChem CID | 87135662 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 2-methoxybenzaldehyde;2-oxabicyclo[2.1.0]pentane |
| SMILES | C1OC2CC12.COc1ccccc1C=O |
| InChI | InChI=1S/C8H8O2.C4H6O/c1-10-8-5-3-2-4-7(8)6-9;1-3-2-5-4(1)3/h2-6H,1H3;3-4H,1-2H2 |
| InChIKey | FTSWDTIEKVUCDN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxybenzaldehyde;2-oxabicyclo[2.1.0]pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxybenzaldehyde;2-oxabicyclo[2.1.0]pentane?
The IUPAC name of 2-methoxybenzaldehyde;2-oxabicyclo[2.1.0]pentane (CID 87135662) is 2-methoxybenzaldehyde;2-oxabicyclo[2.1.0]pentane.
What is the SMILES notation for 2-methoxybenzaldehyde;2-oxabicyclo[2.1.0]pentane?
The canonical SMILES for 2-methoxybenzaldehyde;2-oxabicyclo[2.1.0]pentane is C1OC2CC12.COc1ccccc1C=O.
What is the InChIKey of 2-methoxybenzaldehyde;2-oxabicyclo[2.1.0]pentane?
The InChIKey is FTSWDTIEKVUCDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2.C4H6O/c1-10-8-5-3-2-4-7(8)6-9;1-3-2-5-4(1)3/h2-6H,1H3;3-4H,1-2H2.
What are the key properties of 2-methoxybenzaldehyde;2-oxabicyclo[2.1.0]pentane?
2-methoxybenzaldehyde;2-oxabicyclo[2.1.0]pentane has a molecular weight of 206.24 g/mol, XLogP of 1.91, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxybenzaldehyde;2-oxabicyclo[2.1.0]pentane is sourced from PubChem (CID 87135662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).