C18H20O3 — CID 175295134
cyclopropane;2-methoxybenzaldehyde;2-oxabicyclo[2.2.2]octa-1(6),4,7-triene (PubChem CID 175295134) has the molecular formula C18H20O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is cyclopropane;2-methoxybenzaldehyde;2-oxabicyclo[2.2.2]octa-1(6),4,7-triene.
| Compound Name | cyclopropane;2-methoxybenzaldehyde;2-oxabicyclo[2.2.2]octa-1(6),4,7-triene |
|---|---|
| PubChem CID | 175295134 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | cyclopropane;2-methoxybenzaldehyde;2-oxabicyclo[2.2.2]octa-1(6),4,7-triene |
| SMILES | C1CC1.COc1ccccc1C=O.c1cc2ccc1CO2 |
| InChI | InChI=1S/C8H8O2.C7H6O.C3H6/c1-10-8-5-3-2-4-7(8)6-9;1-3-7-4-2-6(1)5-8-7;1-2-3-1/h2-6H,1H3;1-4H,5H2;1-3H2 |
| InChIKey | YRDJHGNIRYZOMB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|