About hydroxy-octyl-oxophosphanium;nickel
hydroxy-octyl-oxophosphanium;nickel (PubChem CID 87136142) has the molecular formula C8H18NiO2P+
and a molecular weight of 235.90 g/mol. Its IUPAC name is hydroxy-octyl-oxophosphanium;nickel.
Molecular Properties
| Compound Name | hydroxy-octyl-oxophosphanium;nickel |
| PubChem CID | 87136142 |
| Molecular Formula | C8H18NiO2P+ |
| Molecular Weight | 235.90 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | hydroxy-octyl-oxophosphanium;nickel |
| SMILES | CCCCCCCC[P+](=O)O.[Ni] |
| InChI | InChI=1S/C8H17O2P.Ni/c1-2-3-4-5-6-7-8-11(9)10;/h2-8H2,1H3;/p+1 |
| InChIKey | LPPPMCWREXBEHB-UHFFFAOYSA-O |
| XLogP | 3.08 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.90 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hydroxy-octyl-oxophosphanium;nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy-octyl-oxophosphanium;nickel?
The IUPAC name of hydroxy-octyl-oxophosphanium;nickel (CID 87136142) is hydroxy-octyl-oxophosphanium;nickel.
What is the SMILES notation for hydroxy-octyl-oxophosphanium;nickel?
The canonical SMILES for hydroxy-octyl-oxophosphanium;nickel is CCCCCCCC[P+](=O)O.[Ni].
What is the InChIKey of hydroxy-octyl-oxophosphanium;nickel?
The InChIKey is LPPPMCWREXBEHB-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H17O2P.Ni/c1-2-3-4-5-6-7-8-11(9)10;/h2-8H2,1H3;/p+1.
What are the key properties of hydroxy-octyl-oxophosphanium;nickel?
hydroxy-octyl-oxophosphanium;nickel has a molecular weight of 235.90 g/mol, XLogP of 3.08, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy-octyl-oxophosphanium;nickel is sourced from PubChem (CID 87136142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).